C9H15N5O3S — CID 114175973
5-(methylamino)-N-[2-(methylsulfamoyl)ethyl]pyrazine-2-carboxamide (PubChem CID 114175973) has the molecular formula C9H15N5O3S and a molecular weight of 273.32 g/mol. Its IUPAC name is 5-(methylamino)-N-[2-(methylsulfamoyl)ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-(methylamino)-N-[2-(methylsulfamoyl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 114175973 |
| Molecular Formula | C9H15N5O3S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5-(methylamino)-N-[2-(methylsulfamoyl)ethyl]pyrazine-2-carboxamide |
| SMILES | CNc1cnc(C(=O)NCCS(=O)(=O)NC)cn1 |
| InChI | InChI=1S/C9H15N5O3S/c1-10-8-6-13-7(5-14-8)9(15)12-3-4-18(16,17)11-2/h5-6,11H,3-4H2,1-2H3,(H,10,14)(H,12,15) |
| InChIKey | SOCAKZRVYJJQNG-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |