C9H11N7O — CID 107377514
5-hydrazinyl-N-(1-methylpyrazol-3-yl)pyrazine-2-carboxamide (PubChem CID 107377514) has the molecular formula C9H11N7O and a molecular weight of 233.24 g/mol. Its IUPAC name is 5-hydrazinyl-N-(1-methylpyrazol-3-yl)pyrazine-2-carboxamide.
| Compound Name | 5-hydrazinyl-N-(1-methylpyrazol-3-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107377514 |
| Molecular Formula | C9H11N7O |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 5-hydrazinyl-N-(1-methylpyrazol-3-yl)pyrazine-2-carboxamide |
| SMILES | Cn1ccc(NC(=O)c2cnc(NN)cn2)n1 |
| InChI | InChI=1S/C9H11N7O/c1-16-3-2-7(15-16)13-9(17)6-4-12-8(14-10)5-11-6/h2-5H,10H2,1H3,(H,12,14)(H,13,15,17) |
| InChIKey | VBFLSNDUPYXBQE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|