C12H17N5O2 — CID 107378293
(5-hydrazinylpyrazin-2-yl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone (PubChem CID 107378293) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is (5-hydrazinylpyrazin-2-yl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone.
| Compound Name | (5-hydrazinylpyrazin-2-yl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone |
|---|---|
| PubChem CID | 107378293 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (5-hydrazinylpyrazin-2-yl)-(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methanone |
| SMILES | NNc1cnc(C(=O)N2C3CCC2CC(O)C3)cn1 |
| InChI | InChI=1S/C12H17N5O2/c13-16-11-6-14-10(5-15-11)12(19)17-7-1-2-8(17)4-9(18)3-7/h5-9,18H,1-4,13H2,(H,15,16) |
| InChIKey | HIOMYBGRXJLROB-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|