C9H13N5O3 — CID 107378752
(3,4-dihydroxypyrrolidin-1-yl)-(5-hydrazinylpyrazin-2-yl)methanone (PubChem CID 107378752) has the molecular formula C9H13N5O3 and a molecular weight of 239.24 g/mol. Its IUPAC name is (3,4-dihydroxypyrrolidin-1-yl)-(5-hydrazinylpyrazin-2-yl)methanone.
| Compound Name | (3,4-dihydroxypyrrolidin-1-yl)-(5-hydrazinylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 107378752 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | (3,4-dihydroxypyrrolidin-1-yl)-(5-hydrazinylpyrazin-2-yl)methanone |
| SMILES | NNc1cnc(C(=O)N2CC(O)C(O)C2)cn1 |
| InChI | InChI=1S/C9H13N5O3/c10-13-8-2-11-5(1-12-8)9(17)14-3-6(15)7(16)4-14/h1-2,6-7,15-16H,3-4,10H2,(H,12,13) |
| InChIKey | PLMOXPJKHSLTDS-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|