C21H27N3O3 — CID 10737841
4-[2-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl-methylamino]ethyl]-2-nitroaniline (PubChem CID 10737841) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 4-[2-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl-methylamino]ethyl]-2-nitroaniline.
| Compound Name | 4-[2-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl-methylamino]ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 10737841 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 4-[2-[[(1R)-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl]methyl-methylamino]ethyl]-2-nitroaniline |
| SMILES | COc1cccc2c1CCC[C@H]2CN(C)CCc1ccc(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H27N3O3/c1-23(12-11-15-9-10-19(22)20(13-15)24(25)26)14-16-5-3-7-18-17(16)6-4-8-21(18)27-2/h4,6,8-10,13,16H,3,5,7,11-12,14,22H2,1-2H3/t16-/m0/s1 |
| InChIKey | LFSJYRZAMPRASA-INIZCTEOSA-N |
| XLogP | 3.78 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|