C15H17FN4 — CID 107379625
5-[(cyclopropylamino)methyl]-N-(2-fluorophenyl)-N-methylpyrazin-2-amine (PubChem CID 107379625) has the molecular formula C15H17FN4 and a molecular weight of 272.33 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-N-(2-fluorophenyl)-N-methylpyrazin-2-amine.
| Compound Name | 5-[(cyclopropylamino)methyl]-N-(2-fluorophenyl)-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 107379625 |
| Molecular Formula | C15H17FN4 |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-N-(2-fluorophenyl)-N-methylpyrazin-2-amine |
| SMILES | CN(c1cnc(CNC2CC2)cn1)c1ccccc1F |
| InChI | InChI=1S/C15H17FN4/c1-20(14-5-3-2-4-13(14)16)15-10-18-12(9-19-15)8-17-11-6-7-11/h2-5,9-11,17H,6-8H2,1H3 |
| InChIKey | MFYMRTYOLGBSIX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |