C16H18FN3 — CID 62294639
6-[(cyclopropylamino)methyl]-N-(2-fluorophenyl)-N-methylpyridin-2-amine (PubChem CID 62294639) has the molecular formula C16H18FN3 and a molecular weight of 271.34 g/mol. Its IUPAC name is 6-[(cyclopropylamino)methyl]-N-(2-fluorophenyl)-N-methylpyridin-2-amine.
| Compound Name | 6-[(cyclopropylamino)methyl]-N-(2-fluorophenyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 62294639 |
| Molecular Formula | C16H18FN3 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 6-[(cyclopropylamino)methyl]-N-(2-fluorophenyl)-N-methylpyridin-2-amine |
| SMILES | CN(c1cccc(CNC2CC2)n1)c1ccccc1F |
| InChI | InChI=1S/C16H18FN3/c1-20(15-7-3-2-6-14(15)17)16-8-4-5-13(19-16)11-18-12-9-10-12/h2-8,12,18H,9-11H2,1H3 |
| InChIKey | OSOIMOCJZQCXEY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |