C13H18N4S — CID 107379721
N-ethyl-5-(methylaminomethyl)-N-(thiophen-2-ylmethyl)pyrazin-2-amine (PubChem CID 107379721) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is N-ethyl-5-(methylaminomethyl)-N-(thiophen-2-ylmethyl)pyrazin-2-amine.
| Compound Name | N-ethyl-5-(methylaminomethyl)-N-(thiophen-2-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 107379721 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-ethyl-5-(methylaminomethyl)-N-(thiophen-2-ylmethyl)pyrazin-2-amine |
| SMILES | CCN(Cc1cccs1)c1cnc(CNC)cn1 |
| InChI | InChI=1S/C13H18N4S/c1-3-17(10-12-5-4-6-18-12)13-9-15-11(7-14-2)8-16-13/h4-6,8-9,14H,3,7,10H2,1-2H3 |
| InChIKey | NWOKSFHZIQKVGA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |