C16H22N4O2S — CID 122054307
5-[2-(diethylamino)ethyl-(thiophen-2-ylmethyl)amino]pyrazine-2-carboxylic acid (PubChem CID 122054307) has the molecular formula C16H22N4O2S and a molecular weight of 334.44 g/mol. Its IUPAC name is 5-[2-(diethylamino)ethyl-(thiophen-2-ylmethyl)amino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[2-(diethylamino)ethyl-(thiophen-2-ylmethyl)amino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122054307 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 5-[2-(diethylamino)ethyl-(thiophen-2-ylmethyl)amino]pyrazine-2-carboxylic acid |
| SMILES | CCN(CC)CCN(Cc1cccs1)c1cnc(C(=O)O)cn1 |
| InChI | InChI=1S/C16H22N4O2S/c1-3-19(4-2)7-8-20(12-13-6-5-9-23-13)15-11-17-14(10-18-15)16(21)22/h5-6,9-11H,3-4,7-8,12H2,1-2H3,(H,21,22) |
| InChIKey | JIJRFYITYIAVTC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |