C12H22N4O2S — CID 107380534
N-methyl-N-(2-methylsulfonylethyl)-5-[(propan-2-ylamino)methyl]pyrazin-2-amine (PubChem CID 107380534) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-methyl-N-(2-methylsulfonylethyl)-5-[(propan-2-ylamino)methyl]pyrazin-2-amine.
| Compound Name | N-methyl-N-(2-methylsulfonylethyl)-5-[(propan-2-ylamino)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 107380534 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-methyl-N-(2-methylsulfonylethyl)-5-[(propan-2-ylamino)methyl]pyrazin-2-amine |
| SMILES | CC(C)NCc1cnc(N(C)CCS(C)(=O)=O)cn1 |
| InChI | InChI=1S/C12H22N4O2S/c1-10(2)13-7-11-8-15-12(9-14-11)16(3)5-6-19(4,17)18/h8-10,13H,5-7H2,1-4H3 |
| InChIKey | BDLQEEVWRVKLLP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |