C10H16N2O3S — CID 79849577
[6-[methyl(2-methylsulfonylethyl)amino]-3-pyridinyl]methanol (PubChem CID 79849577) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is [6-[methyl(2-methylsulfonylethyl)amino]-3-pyridinyl]methanol.
| Compound Name | [6-[methyl(2-methylsulfonylethyl)amino]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 79849577 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | [6-[methyl(2-methylsulfonylethyl)amino]-3-pyridinyl]methanol |
| SMILES | CN(CCS(C)(=O)=O)c1ccc(CO)cn1 |
| InChI | InChI=1S/C10H16N2O3S/c1-12(5-6-16(2,14)15)10-4-3-9(8-13)7-11-10/h3-4,7,13H,5-6,8H2,1-2H3 |
| InChIKey | YXZYARPVMWJWTR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |