C12H18N2O — CID 107383609
3-[(1-methylpyrazol-3-yl)methyl]cyclohept-2-en-1-ol (PubChem CID 107383609) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-[(1-methylpyrazol-3-yl)methyl]cyclohept-2-en-1-ol.
| Compound Name | 3-[(1-methylpyrazol-3-yl)methyl]cyclohept-2-en-1-ol |
|---|---|
| PubChem CID | 107383609 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-[(1-methylpyrazol-3-yl)methyl]cyclohept-2-en-1-ol |
| SMILES | Cn1ccc(CC2=CC(O)CCCC2)n1 |
| InChI | InChI=1S/C12H18N2O/c1-14-7-6-11(13-14)8-10-4-2-3-5-12(15)9-10/h6-7,9,12,15H,2-5,8H2,1H3 |
| InChIKey | FMGZPEIHMDRRQU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|