C12H21N3O — CID 82870793
2-(aminomethyl)-2-[(1-methylpyrazol-3-yl)methyl]cyclohexan-1-ol (PubChem CID 82870793) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(aminomethyl)-2-[(1-methylpyrazol-3-yl)methyl]cyclohexan-1-ol.
| Compound Name | 2-(aminomethyl)-2-[(1-methylpyrazol-3-yl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 82870793 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-(aminomethyl)-2-[(1-methylpyrazol-3-yl)methyl]cyclohexan-1-ol |
| SMILES | Cn1ccc(CC2(CN)CCCCC2O)n1 |
| InChI | InChI=1S/C12H21N3O/c1-15-7-5-10(14-15)8-12(9-13)6-3-2-4-11(12)16/h5,7,11,16H,2-4,6,8-9,13H2,1H3 |
| InChIKey | LWMKNPWFLANGNL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |