C15H23NO — CID 65393602
2-(aminomethyl)-2-[(2-methylphenyl)methyl]cyclohexan-1-ol (PubChem CID 65393602) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 2-(aminomethyl)-2-[(2-methylphenyl)methyl]cyclohexan-1-ol.
| Compound Name | 2-(aminomethyl)-2-[(2-methylphenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65393602 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2-(aminomethyl)-2-[(2-methylphenyl)methyl]cyclohexan-1-ol |
| SMILES | Cc1ccccc1CC1(CN)CCCCC1O |
| InChI | InChI=1S/C15H23NO/c1-12-6-2-3-7-13(12)10-15(11-16)9-5-4-8-14(15)17/h2-3,6-7,14,17H,4-5,8-11,16H2,1H3 |
| InChIKey | OMLBZQHIMIPAOB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |