C14H19Cl2NO — CID 107310642
2-(aminomethyl)-2-[(2,3-dichlorophenyl)methyl]cyclohexan-1-ol (PubChem CID 107310642) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is 2-(aminomethyl)-2-[(2,3-dichlorophenyl)methyl]cyclohexan-1-ol.
| Compound Name | 2-(aminomethyl)-2-[(2,3-dichlorophenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 107310642 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(aminomethyl)-2-[(2,3-dichlorophenyl)methyl]cyclohexan-1-ol |
| SMILES | NCC1(Cc2cccc(Cl)c2Cl)CCCCC1O |
| InChI | InChI=1S/C14H19Cl2NO/c15-11-5-3-4-10(13(11)16)8-14(9-17)7-2-1-6-12(14)18/h3-5,12,18H,1-2,6-9,17H2 |
| InChIKey | BSOCYAPXLFLVHP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |