C12H15Cl2NS — CID 107310660
[2-[(2,3-dichlorophenyl)methyl]thiolan-2-yl]methanamine (PubChem CID 107310660) has the molecular formula C12H15Cl2NS and a molecular weight of 276.23 g/mol. Its IUPAC name is [2-[(2,3-dichlorophenyl)methyl]thiolan-2-yl]methanamine.
| Compound Name | [2-[(2,3-dichlorophenyl)methyl]thiolan-2-yl]methanamine |
|---|---|
| PubChem CID | 107310660 |
| Molecular Formula | C12H15Cl2NS |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | [2-[(2,3-dichlorophenyl)methyl]thiolan-2-yl]methanamine |
| SMILES | NCC1(Cc2cccc(Cl)c2Cl)CCCS1 |
| InChI | InChI=1S/C12H15Cl2NS/c13-10-4-1-3-9(11(10)14)7-12(8-15)5-2-6-16-12/h1,3-4H,2,5-8,15H2 |
| InChIKey | CYPCCCXXTJKREW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |