C12H14Cl2O — CID 107309473
1-[1-[(2,3-dichlorophenyl)methyl]cyclopropyl]ethanol (PubChem CID 107309473) has the molecular formula C12H14Cl2O and a molecular weight of 245.15 g/mol. Its IUPAC name is 1-[1-[(2,3-dichlorophenyl)methyl]cyclopropyl]ethanol.
| Compound Name | 1-[1-[(2,3-dichlorophenyl)methyl]cyclopropyl]ethanol |
|---|---|
| PubChem CID | 107309473 |
| Molecular Formula | C12H14Cl2O |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-[1-[(2,3-dichlorophenyl)methyl]cyclopropyl]ethanol |
| SMILES | CC(O)C1(Cc2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C12H14Cl2O/c1-8(15)12(5-6-12)7-9-3-2-4-10(13)11(9)14/h2-4,8,15H,5-7H2,1H3 |
| InChIKey | CHKUWVCFIMQDMK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |