C14H19BrFNO — CID 65394850
2-(aminomethyl)-2-[(3-bromo-4-fluorophenyl)methyl]cyclohexan-1-ol (PubChem CID 65394850) has the molecular formula C14H19BrFNO and a molecular weight of 316.21 g/mol. Its IUPAC name is 2-(aminomethyl)-2-[(3-bromo-4-fluorophenyl)methyl]cyclohexan-1-ol.
| Compound Name | 2-(aminomethyl)-2-[(3-bromo-4-fluorophenyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 65394850 |
| Molecular Formula | C14H19BrFNO |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-(aminomethyl)-2-[(3-bromo-4-fluorophenyl)methyl]cyclohexan-1-ol |
| SMILES | NCC1(Cc2ccc(F)c(Br)c2)CCCCC1O |
| InChI | InChI=1S/C14H19BrFNO/c15-11-7-10(4-5-12(11)16)8-14(9-17)6-2-1-3-13(14)18/h4-5,7,13,18H,1-3,6,8-9,17H2 |
| InChIKey | CTHWHAGBYOQZEO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |