C14H18O2 — CID 107383616
3-(2-methoxyphenyl)cyclohept-2-en-1-ol (PubChem CID 107383616) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)cyclohept-2-en-1-ol.
| Compound Name | 3-(2-methoxyphenyl)cyclohept-2-en-1-ol |
|---|---|
| PubChem CID | 107383616 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 3-(2-methoxyphenyl)cyclohept-2-en-1-ol |
| SMILES | COc1ccccc1C1=CC(O)CCCC1 |
| InChI | InChI=1S/C14H18O2/c1-16-14-9-5-4-8-13(14)11-6-2-3-7-12(15)10-11/h4-5,8-10,12,15H,2-3,6-7H2,1H3 |
| InChIKey | FXQWFCWQNKWRNE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |