C15H16N4OS — CID 9464124
(9aS)-3-(2-methoxyphenyl)-7,8,9,9a-tetrahydro-6H-[1,2,4]triazolo[4,3-b][4,1,2]benzothiadiazine (PubChem CID 9464124) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is (9aS)-3-(2-methoxyphenyl)-7,8,9,9a-tetrahydro-6H-[1,2,4]triazolo[4,3-b][4,1,2]benzothiadiazine.
| Compound Name | (9aS)-3-(2-methoxyphenyl)-7,8,9,9a-tetrahydro-6H-[1,2,4]triazolo[4,3-b][4,1,2]benzothiadiazine |
|---|---|
| PubChem CID | 9464124 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (9aS)-3-(2-methoxyphenyl)-7,8,9,9a-tetrahydro-6H-[1,2,4]triazolo[4,3-b][4,1,2]benzothiadiazine |
| SMILES | COc1ccccc1-c1nnc2n1N=C1CCCC[C@@H]1S2 |
| InChI | InChI=1S/C15H16N4OS/c1-20-12-8-4-2-6-10(12)14-16-17-15-19(14)18-11-7-3-5-9-13(11)21-15/h2,4,6,8,13H,3,5,7,9H2,1H3/t13-/m0/s1 |
| InChIKey | MUCQFAGZFIZKQJ-ZDUSSCGKSA-N |
| XLogP | 3.21 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |