C20H20N4O3S — CID 39965905
(7R)-3-(2,4-dimethoxyphenyl)-6-(4-methoxyphenyl)-7-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 39965905) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is (7R)-3-(2,4-dimethoxyphenyl)-6-(4-methoxyphenyl)-7-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | (7R)-3-(2,4-dimethoxyphenyl)-6-(4-methoxyphenyl)-7-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 39965905 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (7R)-3-(2,4-dimethoxyphenyl)-6-(4-methoxyphenyl)-7-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | COc1ccc(C2=Nn3c(nnc3-c3ccc(OC)cc3OC)S[C@@H]2C)cc1 |
| InChI | InChI=1S/C20H20N4O3S/c1-12-18(13-5-7-14(25-2)8-6-13)23-24-19(21-22-20(24)28-12)16-10-9-15(26-3)11-17(16)27-4/h5-12H,1-4H3/t12-/m1/s1 |
| InChIKey | VUZUNFWEOZTLQO-GFCCVEGCSA-N |
| XLogP | 3.72 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |