C19H18N4O2S — CID 135763091
2-[(7S)-3-(4-ethoxyphenyl)-7-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol (PubChem CID 135763091) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 2-[(7S)-3-(4-ethoxyphenyl)-7-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol.
| Compound Name | 2-[(7S)-3-(4-ethoxyphenyl)-7-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol |
|---|---|
| PubChem CID | 135763091 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[(7S)-3-(4-ethoxyphenyl)-7-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-yl]phenol |
| SMILES | CCOc1ccc(-c2nnc3n2N=C(c2ccccc2O)[C@H](C)S3)cc1 |
| InChI | InChI=1S/C19H18N4O2S/c1-3-25-14-10-8-13(9-11-14)18-20-21-19-23(18)22-17(12(2)26-19)15-6-4-5-7-16(15)24/h4-12,24H,3H2,1-2H3/t12-/m0/s1 |
| InChIKey | ARGKTOLTNCAHPM-LBPRGKRZSA-N |
| XLogP | 3.80 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|