C16H16N2O2S — CID 797959
2-[(2R)-2-(4-ethoxyphenyl)-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol (PubChem CID 797959) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[(2R)-2-(4-ethoxyphenyl)-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol.
| Compound Name | 2-[(2R)-2-(4-ethoxyphenyl)-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 797959 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[(2R)-2-(4-ethoxyphenyl)-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol |
| SMILES | CCOc1ccc([C@@H]2NN=C(c3ccccc3O)S2)cc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-2-20-12-9-7-11(8-10-12)15-17-18-16(21-15)13-5-3-4-6-14(13)19/h3-10,15,17,19H,2H2,1H3/t15-/m1/s1 |
| InChIKey | FUKCQKKNINYVNK-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|