C18H14N2OS — CID 135562299
2-[(2R)-2-naphthalen-2-yl-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol (PubChem CID 135562299) has the molecular formula C18H14N2OS and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[(2R)-2-naphthalen-2-yl-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol.
| Compound Name | 2-[(2R)-2-naphthalen-2-yl-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 135562299 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-[(2R)-2-naphthalen-2-yl-2,3-dihydro-1,3,4-thiadiazol-5-yl]phenol |
| SMILES | Oc1ccccc1C1=NN[C@@H](c2ccc3ccccc3c2)S1 |
| InChI | InChI=1S/C18H14N2OS/c21-16-8-4-3-7-15(16)18-20-19-17(22-18)14-10-9-12-5-1-2-6-13(12)11-14/h1-11,17,19,21H/t17-/m1/s1 |
| InChIKey | UPSFLYNKZIBVCC-QGZVFWFLSA-N |
| XLogP | 4.24 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|