About 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol
4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol (PubChem CID 107386395) has the molecular formula C14H22N2O4
and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol.
Molecular Properties
| Compound Name | 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol |
| PubChem CID | 107386395 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol |
| SMILES | Cc1ncc(CO)c(CNCC2COC(C)(C)O2)c1O |
| InChI | InChI=1S/C14H22N2O4/c1-9-13(18)12(10(7-17)4-16-9)6-15-5-11-8-19-14(2,3)20-11/h4,11,15,17-18H,5-8H2,1-3H3 |
| InChIKey | DKBZOWBQZITOLA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
The IUPAC name of 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol (CID 107386395) is 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol.
What is the SMILES notation for 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
The canonical SMILES for 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol is Cc1ncc(CO)c(CNCC2COC(C)(C)O2)c1O.
What is the InChIKey of 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
The InChIKey is DKBZOWBQZITOLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O4/c1-9-13(18)12(10(7-17)4-16-9)6-15-5-11-8-19-14(2,3)20-11/h4,11,15,17-18H,5-8H2,1-3H3.
What are the key properties of 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol?
4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol has a molecular weight of 282.34 g/mol, XLogP of 0.83, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]methyl]-5-(hydroxymethyl)-2-methylpyridin-3-ol is sourced from PubChem (CID 107386395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).