C16H11Cl2NO — CID 107388172
3-[(2,4-dichlorophenyl)methoxy]quinoline (PubChem CID 107388172) has the molecular formula C16H11Cl2NO and a molecular weight of 304.18 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methoxy]quinoline.
| Compound Name | 3-[(2,4-dichlorophenyl)methoxy]quinoline |
|---|---|
| PubChem CID | 107388172 |
| Molecular Formula | C16H11Cl2NO |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methoxy]quinoline |
| SMILES | Clc1ccc(COc2cnc3ccccc3c2)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2NO/c17-13-6-5-12(15(18)8-13)10-20-14-7-11-3-1-2-4-16(11)19-9-14/h1-9H,10H2 |
| InChIKey | PTPJUBYIBYHXOJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |