C13H22N4O4 — CID 107389340
N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-4-nitro-1-propylpyrazol-5-amine (PubChem CID 107389340) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-4-nitro-1-propylpyrazol-5-amine.
| Compound Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-4-nitro-1-propylpyrazol-5-amine |
|---|---|
| PubChem CID | 107389340 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-4-nitro-1-propylpyrazol-5-amine |
| SMILES | CCCn1nc(C)c([N+](=O)[O-])c1NCC1COC(C)(C)O1 |
| InChI | InChI=1S/C13H22N4O4/c1-5-6-16-12(11(17(18)19)9(2)15-16)14-7-10-8-20-13(3,4)21-10/h10,14H,5-8H2,1-4H3 |
| InChIKey | VTOWVWUELTTYDT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|