C10H22N2O3S — CID 107392208
2-(3-methoxy-3-methylpiperidin-1-yl)sulfonylpropan-1-amine (PubChem CID 107392208) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-(3-methoxy-3-methylpiperidin-1-yl)sulfonylpropan-1-amine.
| Compound Name | 2-(3-methoxy-3-methylpiperidin-1-yl)sulfonylpropan-1-amine |
|---|---|
| PubChem CID | 107392208 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-(3-methoxy-3-methylpiperidin-1-yl)sulfonylpropan-1-amine |
| SMILES | COC1(C)CCCN(S(=O)(=O)C(C)CN)C1 |
| InChI | InChI=1S/C10H22N2O3S/c1-9(7-11)16(13,14)12-6-4-5-10(2,8-12)15-3/h9H,4-8,11H2,1-3H3 |
| InChIKey | FKENCUUVNCNHMP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |