C15H20FNO3 — CID 107392243
(2-fluoro-4-methoxyphenyl)-(3-methoxy-3-methylpiperidin-1-yl)methanone (PubChem CID 107392243) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is (2-fluoro-4-methoxyphenyl)-(3-methoxy-3-methylpiperidin-1-yl)methanone.
| Compound Name | (2-fluoro-4-methoxyphenyl)-(3-methoxy-3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 107392243 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2-fluoro-4-methoxyphenyl)-(3-methoxy-3-methylpiperidin-1-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCC(C)(OC)C2)c(F)c1 |
| InChI | InChI=1S/C15H20FNO3/c1-15(20-3)7-4-8-17(10-15)14(18)12-6-5-11(19-2)9-13(12)16/h5-6,9H,4,7-8,10H2,1-3H3 |
| InChIKey | JDRGJBMJSQJVFZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |