C14H19NO4 — CID 115875374
(2-hydroxy-5-methoxyphenyl)-(3-hydroxy-3-methylpiperidin-1-yl)methanone (PubChem CID 115875374) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2-hydroxy-5-methoxyphenyl)-(3-hydroxy-3-methylpiperidin-1-yl)methanone.
| Compound Name | (2-hydroxy-5-methoxyphenyl)-(3-hydroxy-3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 115875374 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2-hydroxy-5-methoxyphenyl)-(3-hydroxy-3-methylpiperidin-1-yl)methanone |
| SMILES | COc1ccc(O)c(C(=O)N2CCCC(C)(O)C2)c1 |
| InChI | InChI=1S/C14H19NO4/c1-14(18)6-3-7-15(9-14)13(17)11-8-10(19-2)4-5-12(11)16/h4-5,8,16,18H,3,6-7,9H2,1-2H3 |
| InChIKey | RHKVXARIGPIKJB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |