About 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide
3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide (PubChem CID 107393142) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide |
| PubChem CID | 107393142 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide |
| SMILES | CCC/N=C(\N)N1CCCC(C)(OC)C1 |
| InChI | InChI=1S/C11H23N3O/c1-4-7-13-10(12)14-8-5-6-11(2,9-14)15-3/h4-9H2,1-3H3,(H2,12,13) |
| InChIKey | IMSWHVJLCAYWNP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide?
The IUPAC name of 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide (CID 107393142) is 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide.
What is the SMILES notation for 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide?
The canonical SMILES for 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide is CCC/N=C(\N)N1CCCC(C)(OC)C1.
What is the InChIKey of 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide?
The InChIKey is IMSWHVJLCAYWNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O/c1-4-7-13-10(12)14-8-5-6-11(2,9-14)15-3/h4-9H2,1-3H3,(H2,12,13).
What are the key properties of 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide?
3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide has a molecular weight of 213.32 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-3-methyl-N'-propylpiperidine-1-carboximidamide is sourced from PubChem (CID 107393142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).