C9H19N3O — CID 107393147
3-methoxy-N',3-dimethylpiperidine-1-carboximidamide (PubChem CID 107393147) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-methoxy-N',3-dimethylpiperidine-1-carboximidamide.
| Compound Name | 3-methoxy-N',3-dimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 107393147 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 3-methoxy-N',3-dimethylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\N)N1CCCC(C)(OC)C1 |
| InChI | InChI=1S/C9H19N3O/c1-9(13-3)5-4-6-12(7-9)8(10)11-2/h4-7H2,1-3H3,(H2,10,11) |
| InChIKey | CLVFTGFRCNVZPT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|