C17H36N2O4S2 — CID 10739550
N-[3-[tert-butylsulfonyl(cyclohexyl)amino]propyl]-2-methylpropane-2-sulfonamide (PubChem CID 10739550) has the molecular formula C17H36N2O4S2 and a molecular weight of 396.62 g/mol. Its IUPAC name is N-[3-[tert-butylsulfonyl(cyclohexyl)amino]propyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[3-[tert-butylsulfonyl(cyclohexyl)amino]propyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 10739550 |
| Molecular Formula | C17H36N2O4S2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | N-[3-[tert-butylsulfonyl(cyclohexyl)amino]propyl]-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)NCCCN(C1CCCCC1)S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C17H36N2O4S2/c1-16(2,3)24(20,21)18-13-10-14-19(15-11-8-7-9-12-15)25(22,23)17(4,5)6/h15,18H,7-14H2,1-6H3 |
| InChIKey | SWNXREUGHYENRE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|