C12H27N3O2S — CID 43137026
N'-cycloheptyl-N'-(dimethylsulfamoyl)propane-1,3-diamine (PubChem CID 43137026) has the molecular formula C12H27N3O2S and a molecular weight of 277.43 g/mol. Its IUPAC name is N'-cycloheptyl-N'-(dimethylsulfamoyl)propane-1,3-diamine.
| Compound Name | N'-cycloheptyl-N'-(dimethylsulfamoyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 43137026 |
| Molecular Formula | C12H27N3O2S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N'-cycloheptyl-N'-(dimethylsulfamoyl)propane-1,3-diamine |
| SMILES | CN(C)S(=O)(=O)N(CCCN)C1CCCCCC1 |
| InChI | InChI=1S/C12H27N3O2S/c1-14(2)18(16,17)15(11-7-10-13)12-8-5-3-4-6-9-12/h12H,3-11,13H2,1-2H3 |
| InChIKey | GXXBJMWUVOTKJP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |