C11H25N3O3S — CID 102861380
3-[[3-aminopropyl(methyl)sulfamoyl]-cyclobutylamino]propan-1-ol (PubChem CID 102861380) has the molecular formula C11H25N3O3S and a molecular weight of 279.41 g/mol. Its IUPAC name is 3-[[3-aminopropyl(methyl)sulfamoyl]-cyclobutylamino]propan-1-ol.
| Compound Name | 3-[[3-aminopropyl(methyl)sulfamoyl]-cyclobutylamino]propan-1-ol |
|---|---|
| PubChem CID | 102861380 |
| Molecular Formula | C11H25N3O3S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-[[3-aminopropyl(methyl)sulfamoyl]-cyclobutylamino]propan-1-ol |
| SMILES | CN(CCCN)S(=O)(=O)N(CCCO)C1CCC1 |
| InChI | InChI=1S/C11H25N3O3S/c1-13(8-3-7-12)18(16,17)14(9-4-10-15)11-5-2-6-11/h11,15H,2-10,12H2,1H3 |
| InChIKey | IWGUEZGXKPIMKP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |