C11H24N2O4S2 — CID 55173884
N-(3-aminopropyl)-N-cyclopentyl-2-methylsulfonylethanesulfonamide (PubChem CID 55173884) has the molecular formula C11H24N2O4S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-cyclopentyl-2-methylsulfonylethanesulfonamide.
| Compound Name | N-(3-aminopropyl)-N-cyclopentyl-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 55173884 |
| Molecular Formula | C11H24N2O4S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-(3-aminopropyl)-N-cyclopentyl-2-methylsulfonylethanesulfonamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)N(CCCN)C1CCCC1 |
| InChI | InChI=1S/C11H24N2O4S2/c1-18(14,15)9-10-19(16,17)13(8-4-7-12)11-5-2-3-6-11/h11H,2-10,12H2,1H3 |
| InChIKey | AIABDMBBJXKXBV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |