C18H27NO7Si — CID 10739581
(1R,2R,3S,4S,5S)-2,4-diformyl-5-[(2S)-2-methoxycarbonylpyrrolidine-1-carbonyl]-3-trimethylsilylcyclopentane-1-carboxylic acid (PubChem CID 10739581) has the molecular formula C18H27NO7Si and a molecular weight of 397.50 g/mol. Its IUPAC name is (1R,2R,3S,4S,5S)-2,4-diformyl-5-[(2S)-2-methoxycarbonylpyrrolidine-1-carbonyl]-3-trimethylsilylcyclopentane-1-carboxylic acid.
| Compound Name | (1R,2R,3S,4S,5S)-2,4-diformyl-5-[(2S)-2-methoxycarbonylpyrrolidine-1-carbonyl]-3-trimethylsilylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 10739581 |
| Molecular Formula | C18H27NO7Si |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (1R,2R,3S,4S,5S)-2,4-diformyl-5-[(2S)-2-methoxycarbonylpyrrolidine-1-carbonyl]-3-trimethylsilylcyclopentane-1-carboxylic acid |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)[C@@H]1[C@@H](C=O)[C@H]([Si](C)(C)C)[C@@H](C=O)[C@@H]1C(=O)O |
| InChI | InChI=1S/C18H27NO7Si/c1-26-18(25)12-6-5-7-19(12)16(22)13-10(8-20)15(27(2,3)4)11(9-21)14(13)17(23)24/h8-15H,5-7H2,1-4H3,(H,23,24)/t10-,11+,12+,13-,14+,15+/m1/s1 |
| InChIKey | CTVZOWONVHZSRY-GHRCFYLDSA-N |
| XLogP | 0.82 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|