C18H27NO7Si — CID 177417646
methyl (2S)-1-[(1R,2R,4R,7R,8S,9S,10S)-2-hydroxy-6-oxo-9-trimethylsilyl-3,5-dioxatricyclo[5.2.1.04,8]decane-10-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 177417646) has the molecular formula C18H27NO7Si and a molecular weight of 397.50 g/mol. Its IUPAC name is methyl (2S)-1-[(1R,2R,4R,7R,8S,9S,10S)-2-hydroxy-6-oxo-9-trimethylsilyl-3,5-dioxatricyclo[5.2.1.04,8]decane-10-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(1R,2R,4R,7R,8S,9S,10S)-2-hydroxy-6-oxo-9-trimethylsilyl-3,5-dioxatricyclo[5.2.1.04,8]decane-10-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 177417646 |
| Molecular Formula | C18H27NO7Si |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | methyl (2S)-1-[(1R,2R,4R,7R,8S,9S,10S)-2-hydroxy-6-oxo-9-trimethylsilyl-3,5-dioxatricyclo[5.2.1.04,8]decane-10-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)[C@H]1[C@H]2C(=O)O[C@H]3O[C@@H](O)[C@@H]1[C@H]([Si](C)(C)C)[C@H]32 |
| InChI | InChI=1S/C18H27NO7Si/c1-24-15(21)8-6-5-7-19(8)14(20)9-10-12-13(27(2,3)4)11(9)17(23)26-18(12)25-16(10)22/h8-13,17-18,23H,5-7H2,1-4H3/t8-,9-,10+,11-,12+,13-,17+,18-/m0/s1 |
| InChIKey | VZSYCYQLFODVJV-QXPSXFASSA-N |
| XLogP | 0.57 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|