C14H28N2O2 — CID 107395999
2-cyclopropyl-3-(3-methoxy-3-methylpiperidin-1-yl)-2-(methylamino)propan-1-ol (PubChem CID 107395999) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-cyclopropyl-3-(3-methoxy-3-methylpiperidin-1-yl)-2-(methylamino)propan-1-ol.
| Compound Name | 2-cyclopropyl-3-(3-methoxy-3-methylpiperidin-1-yl)-2-(methylamino)propan-1-ol |
|---|---|
| PubChem CID | 107395999 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2-cyclopropyl-3-(3-methoxy-3-methylpiperidin-1-yl)-2-(methylamino)propan-1-ol |
| SMILES | CNC(CO)(CN1CCCC(C)(OC)C1)C1CC1 |
| InChI | InChI=1S/C14H28N2O2/c1-13(18-3)7-4-8-16(9-13)10-14(11-17,15-2)12-5-6-12/h12,15,17H,4-11H2,1-3H3 |
| InChIKey | FNKPPCQWTHVZHB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |