C12H25NOS — CID 107396246
3-(3-methoxy-3-methylpiperidin-1-yl)-2,2-dimethylpropane-1-thiol (PubChem CID 107396246) has the molecular formula C12H25NOS and a molecular weight of 231.40 g/mol. Its IUPAC name is 3-(3-methoxy-3-methylpiperidin-1-yl)-2,2-dimethylpropane-1-thiol.
| Compound Name | 3-(3-methoxy-3-methylpiperidin-1-yl)-2,2-dimethylpropane-1-thiol |
|---|---|
| PubChem CID | 107396246 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3-(3-methoxy-3-methylpiperidin-1-yl)-2,2-dimethylpropane-1-thiol |
| SMILES | COC1(C)CCCN(CC(C)(C)CS)C1 |
| InChI | InChI=1S/C12H25NOS/c1-11(2,10-15)8-13-7-5-6-12(3,9-13)14-4/h15H,5-10H2,1-4H3 |
| InChIKey | UNGROTRYBDQGMH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|