C14H21N3S — CID 107398831
2-[cyclobutylmethyl(ethyl)amino]-6-methylpyridine-4-carbothioamide (PubChem CID 107398831) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-[cyclobutylmethyl(ethyl)amino]-6-methylpyridine-4-carbothioamide.
| Compound Name | 2-[cyclobutylmethyl(ethyl)amino]-6-methylpyridine-4-carbothioamide |
|---|---|
| PubChem CID | 107398831 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-[cyclobutylmethyl(ethyl)amino]-6-methylpyridine-4-carbothioamide |
| SMILES | CCN(CC1CCC1)c1cc(C(N)=S)cc(C)n1 |
| InChI | InChI=1S/C14H21N3S/c1-3-17(9-11-5-4-6-11)13-8-12(14(15)18)7-10(2)16-13/h7-8,11H,3-6,9H2,1-2H3,(H2,15,18) |
| InChIKey | VKWQIPCCIMETAQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|