C14H21N3OS — CID 114767464
2-[cyclopentyl(2-hydroxyethyl)amino]-6-methylpyridine-4-carbothioamide (PubChem CID 114767464) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-[cyclopentyl(2-hydroxyethyl)amino]-6-methylpyridine-4-carbothioamide.
| Compound Name | 2-[cyclopentyl(2-hydroxyethyl)amino]-6-methylpyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114767464 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-[cyclopentyl(2-hydroxyethyl)amino]-6-methylpyridine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(N(CCO)C2CCCC2)n1 |
| InChI | InChI=1S/C14H21N3OS/c1-10-8-11(14(15)19)9-13(16-10)17(6-7-18)12-4-2-3-5-12/h8-9,12,18H,2-7H2,1H3,(H2,15,19) |
| InChIKey | WZBRLYVJCGRCMI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|