C17H28N4 — CID 114769116
2-[cyclopentyl(3-methylbutyl)amino]-6-methylpyridine-4-carboximidamide (PubChem CID 114769116) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-[cyclopentyl(3-methylbutyl)amino]-6-methylpyridine-4-carboximidamide.
| Compound Name | 2-[cyclopentyl(3-methylbutyl)amino]-6-methylpyridine-4-carboximidamide |
|---|---|
| PubChem CID | 114769116 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-[cyclopentyl(3-methylbutyl)amino]-6-methylpyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(N(CCC(C)C)C2CCCC2)c1 |
| InChI | InChI=1S/C17H28N4/c1-12(2)8-9-21(15-6-4-5-7-15)16-11-14(17(18)19)10-13(3)20-16/h10-12,15H,4-9H2,1-3H3,(H3,18,19) |
| InChIKey | ARDBTEWCFCDKIA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|