C19H18BrClN2O — CID 10740075
N-[2-[1-[(2-bromophenyl)methyl]-5-chloroindol-3-yl]ethyl]acetamide (PubChem CID 10740075) has the molecular formula C19H18BrClN2O and a molecular weight of 405.72 g/mol. Its IUPAC name is N-[2-[1-[(2-bromophenyl)methyl]-5-chloroindol-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[1-[(2-bromophenyl)methyl]-5-chloroindol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 10740075 |
| Molecular Formula | C19H18BrClN2O |
| Molecular Weight | 405.72 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | N-[2-[1-[(2-bromophenyl)methyl]-5-chloroindol-3-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1cn(Cc2ccccc2Br)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H18BrClN2O/c1-13(24)22-9-8-14-11-23(12-15-4-2-3-5-18(15)20)19-7-6-16(21)10-17(14)19/h2-7,10-11H,8-9,12H2,1H3,(H,22,24) |
| InChIKey | WLKSIMRKBBEWRH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |