C11H21F3N2O — CID 107403982
1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylazepan-4-ol (PubChem CID 107403982) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylazepan-4-ol.
| Compound Name | 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylazepan-4-ol |
|---|---|
| PubChem CID | 107403982 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-(4-amino-1,1,1-trifluorobutan-2-yl)-4-methylazepan-4-ol |
| SMILES | CC1(O)CCCN(C(CCN)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H21F3N2O/c1-10(17)4-2-7-16(8-5-10)9(3-6-15)11(12,13)14/h9,17H,2-8,15H2,1H3 |
| InChIKey | TZEUPTPGQUHSNG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |