C22H20ClFN2O3 — CID 10740550
2-[[1-(3-chloro-4-methylbenzoyl)-4-fluoropiperidin-4-yl]methyl]isoindole-1,3-dione (PubChem CID 10740550) has the molecular formula C22H20ClFN2O3 and a molecular weight of 414.86 g/mol. Its IUPAC name is 2-[[1-(3-chloro-4-methylbenzoyl)-4-fluoropiperidin-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[1-(3-chloro-4-methylbenzoyl)-4-fluoropiperidin-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10740550 |
| Molecular Formula | C22H20ClFN2O3 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-[[1-(3-chloro-4-methylbenzoyl)-4-fluoropiperidin-4-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(C(=O)N2CCC(F)(CN3C(=O)c4ccccc4C3=O)CC2)cc1Cl |
| InChI | InChI=1S/C22H20ClFN2O3/c1-14-6-7-15(12-18(14)23)19(27)25-10-8-22(24,9-11-25)13-26-20(28)16-4-2-3-5-17(16)21(26)29/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | DSXMNUUBAYWYQS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|