C25H24ClFN2O — CID 134796278
[4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]piperazin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 134796278) has the molecular formula C25H24ClFN2O and a molecular weight of 422.93 g/mol. Its IUPAC name is [4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]piperazin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]piperazin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 134796278 |
| Molecular Formula | C25H24ClFN2O |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [4-[[2-(3-chloro-4-methylphenyl)phenyl]methyl]piperazin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | Cc1ccc(-c2ccccc2CN2CCN(C(=O)c3ccc(F)cc3)CC2)cc1Cl |
| InChI | InChI=1S/C25H24ClFN2O/c1-18-6-7-20(16-24(18)26)23-5-3-2-4-21(23)17-28-12-14-29(15-13-28)25(30)19-8-10-22(27)11-9-19/h2-11,16H,12-15,17H2,1H3 |
| InChIKey | MEASWNWNCXKWHH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |