C15H28N2O4 — CID 107405732
3-[tert-butyl-(4-hydroxy-4-methylazepane-1-carbonyl)amino]propanoic acid (PubChem CID 107405732) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-[tert-butyl-(4-hydroxy-4-methylazepane-1-carbonyl)amino]propanoic acid.
| Compound Name | 3-[tert-butyl-(4-hydroxy-4-methylazepane-1-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 107405732 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 3-[tert-butyl-(4-hydroxy-4-methylazepane-1-carbonyl)amino]propanoic acid |
| SMILES | CC1(O)CCCN(C(=O)N(CCC(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H28N2O4/c1-14(2,3)17(10-6-12(18)19)13(20)16-9-5-7-15(4,21)8-11-16/h21H,5-11H2,1-4H3,(H,18,19) |
| InChIKey | VHMUZRFFALGLQY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |