C10H14Cl2N4O — CID 107405815
1-(4,6-dichloro-1,3,5-triazin-2-yl)-4-methylazepan-4-ol (PubChem CID 107405815) has the molecular formula C10H14Cl2N4O and a molecular weight of 277.15 g/mol. Its IUPAC name is 1-(4,6-dichloro-1,3,5-triazin-2-yl)-4-methylazepan-4-ol.
| Compound Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)-4-methylazepan-4-ol |
|---|---|
| PubChem CID | 107405815 |
| Molecular Formula | C10H14Cl2N4O |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-(4,6-dichloro-1,3,5-triazin-2-yl)-4-methylazepan-4-ol |
| SMILES | CC1(O)CCCN(c2nc(Cl)nc(Cl)n2)CC1 |
| InChI | InChI=1S/C10H14Cl2N4O/c1-10(17)3-2-5-16(6-4-10)9-14-7(11)13-8(12)15-9/h17H,2-6H2,1H3 |
| InChIKey | KQOLSFJKTUJQCJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |