C9H14ClN3OS — CID 107405803
1-(4-chloro-1,2,5-thiadiazol-3-yl)-4-methylazepan-4-ol (PubChem CID 107405803) has the molecular formula C9H14ClN3OS and a molecular weight of 247.75 g/mol. Its IUPAC name is 1-(4-chloro-1,2,5-thiadiazol-3-yl)-4-methylazepan-4-ol.
| Compound Name | 1-(4-chloro-1,2,5-thiadiazol-3-yl)-4-methylazepan-4-ol |
|---|---|
| PubChem CID | 107405803 |
| Molecular Formula | C9H14ClN3OS |
| Molecular Weight | 247.75 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 1-(4-chloro-1,2,5-thiadiazol-3-yl)-4-methylazepan-4-ol |
| SMILES | CC1(O)CCCN(c2nsnc2Cl)CC1 |
| InChI | InChI=1S/C9H14ClN3OS/c1-9(14)3-2-5-13(6-4-9)8-7(10)11-15-12-8/h14H,2-6H2,1H3 |
| InChIKey | AIOVCFQHVLIBBP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.75 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |